C21H25NO6 — CID 7984511
butyl 4-[2-(3,4-dimethoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 7984511) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is butyl 4-[2-(3,4-dimethoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | butyl 4-[2-(3,4-dimethoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 7984511 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | butyl 4-[2-(3,4-dimethoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | CCCCOC(=O)c1ccc(OCC(=O)Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H25NO6/c1-4-5-12-27-21(24)15-6-9-17(10-7-15)28-14-20(23)22-16-8-11-18(25-2)19(13-16)26-3/h6-11,13H,4-5,12,14H2,1-3H3,(H,22,23) |
| InChIKey | NRRVLQPQLIOEJV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|