C24H29NO7 — CID 29199685
butyl 4-[[2-[3-(3,4-dimethoxyphenyl)propanoyloxy]acetyl]amino]benzoate (PubChem CID 29199685) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is butyl 4-[[2-[3-(3,4-dimethoxyphenyl)propanoyloxy]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[3-(3,4-dimethoxyphenyl)propanoyloxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 29199685 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | butyl 4-[[2-[3-(3,4-dimethoxyphenyl)propanoyloxy]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)CCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H29NO7/c1-4-5-14-31-24(28)18-8-10-19(11-9-18)25-22(26)16-32-23(27)13-7-17-6-12-20(29-2)21(15-17)30-3/h6,8-12,15H,4-5,7,13-14,16H2,1-3H3,(H,25,26) |
| InChIKey | FQIFNCBTXMAIRC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|