C19H20N2O6 — CID 7766635
[2-(4-carbamoylanilino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 7766635) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 7766635 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)Nc2ccc(C(N)=O)cc2)cc1OC |
| InChI | InChI=1S/C19H20N2O6/c1-25-15-8-3-12(9-16(15)26-2)10-18(23)27-11-17(22)21-14-6-4-13(5-7-14)19(20)24/h3-9H,10-11H2,1-2H3,(H2,20,24)(H,21,22) |
| InChIKey | XFJINGCSWITDIZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |