C22H27NO7 — CID 71823029
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate (PubChem CID 71823029) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate |
|---|---|
| PubChem CID | 71823029 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate |
| SMILES | CCOc1ccc(CC(=O)OCC(=O)Nc2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C22H27NO7/c1-5-28-18-9-7-15(11-20(18)29-6-2)12-22(25)30-14-21(24)23-16-8-10-17(26-3)19(13-16)27-4/h7-11,13H,5-6,12,14H2,1-4H3,(H,23,24) |
| InChIKey | PHKSLIQBPXFOED-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |