C20H21Cl2NO5 — CID 71822991
[2-(3,5-dichloroanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate (PubChem CID 71822991) has the molecular formula C20H21Cl2NO5 and a molecular weight of 426.30 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate |
|---|---|
| PubChem CID | 71822991 |
| Molecular Formula | C20H21Cl2NO5 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate |
| SMILES | CCOc1ccc(CC(=O)OCC(=O)Nc2cc(Cl)cc(Cl)c2)cc1OCC |
| InChI | InChI=1S/C20H21Cl2NO5/c1-3-26-17-6-5-13(7-18(17)27-4-2)8-20(25)28-12-19(24)23-16-10-14(21)9-15(22)11-16/h5-7,9-11H,3-4,8,12H2,1-2H3,(H,23,24) |
| InChIKey | GPEDLXSNCYUPLU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |