C24H31NO5 — CID 71823001
[2-(4-butylanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate (PubChem CID 71823001) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is [2-(4-butylanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate.
| Compound Name | [2-(4-butylanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate |
|---|---|
| PubChem CID | 71823001 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [2-(4-butylanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate |
| SMILES | CCCCc1ccc(NC(=O)COC(=O)Cc2ccc(OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C24H31NO5/c1-4-7-8-18-9-12-20(13-10-18)25-23(26)17-30-24(27)16-19-11-14-21(28-5-2)22(15-19)29-6-3/h9-15H,4-8,16-17H2,1-3H3,(H,25,26) |
| InChIKey | MKQINEJMXDJIEL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |