C20H21F2NO5 — CID 71823024
[2-(2,5-difluoroanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate (PubChem CID 71823024) has the molecular formula C20H21F2NO5 and a molecular weight of 393.39 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate |
|---|---|
| PubChem CID | 71823024 |
| Molecular Formula | C20H21F2NO5 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 2-(3,4-diethoxyphenyl)acetate |
| SMILES | CCOc1ccc(CC(=O)OCC(=O)Nc2cc(F)ccc2F)cc1OCC |
| InChI | InChI=1S/C20H21F2NO5/c1-3-26-17-8-5-13(9-18(17)27-4-2)10-20(25)28-12-19(24)23-16-11-14(21)6-7-15(16)22/h5-9,11H,3-4,10,12H2,1-2H3,(H,23,24) |
| InChIKey | DPNKTCUEUCQSSW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |