C23H27NO7 — CID 71823049
ethyl 2-[[2-[2-(3,4-diethoxyphenyl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 71823049) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(3,4-diethoxyphenyl)acetyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[2-(3,4-diethoxyphenyl)acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 71823049 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | ethyl 2-[[2-[2-(3,4-diethoxyphenyl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)COC(=O)Cc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C23H27NO7/c1-4-28-19-12-11-16(13-20(19)29-5-2)14-22(26)31-15-21(25)24-18-10-8-7-9-17(18)23(27)30-6-3/h7-13H,4-6,14-15H2,1-3H3,(H,24,25) |
| InChIKey | HFSUYLLVWLECNE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |