C17H23NO5 — CID 2348289
ethyl 2-[[2-(3,3-dimethylbutanoyloxy)acetyl]amino]benzoate (PubChem CID 2348289) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is ethyl 2-[[2-(3,3-dimethylbutanoyloxy)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(3,3-dimethylbutanoyloxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2348289 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | ethyl 2-[[2-(3,3-dimethylbutanoyloxy)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)COC(=O)CC(C)(C)C |
| InChI | InChI=1S/C17H23NO5/c1-5-22-16(21)12-8-6-7-9-13(12)18-14(19)11-23-15(20)10-17(2,3)4/h6-9H,5,10-11H2,1-4H3,(H,18,19) |
| InChIKey | QOMGRUHIEGAJMH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |