C12H15NO3 — CID 4190428
ethyl 2-(propanoylamino)benzoate (PubChem CID 4190428) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is ethyl 2-(propanoylamino)benzoate.
| Compound Name | ethyl 2-(propanoylamino)benzoate |
|---|---|
| PubChem CID | 4190428 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | ethyl 2-(propanoylamino)benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CC |
| InChI | InChI=1S/C12H15NO3/c1-3-11(14)13-10-8-6-5-7-9(10)12(15)16-4-2/h5-8H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | QXGUNUGFJISHOL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |