C17H17FN2O3 — CID 18929196
ethyl 2-[[2-(2-fluoroanilino)acetyl]amino]benzoate (PubChem CID 18929196) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is ethyl 2-[[2-(2-fluoroanilino)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(2-fluoroanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18929196 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 2-[[2-(2-fluoroanilino)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CNc1ccccc1F |
| InChI | InChI=1S/C17H17FN2O3/c1-2-23-17(22)12-7-3-5-9-14(12)20-16(21)11-19-15-10-6-4-8-13(15)18/h3-10,19H,2,11H2,1H3,(H,20,21) |
| InChIKey | XFVBEJFUSVQFDL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |