C19H22FN2O3+ — CID 9035217
[2-(2-ethoxycarbonylanilino)-2-oxoethyl]-[(2-fluorophenyl)methyl]-methylazanium (PubChem CID 9035217) has the molecular formula C19H22FN2O3+ and a molecular weight of 345.39 g/mol. Its IUPAC name is [2-(2-ethoxycarbonylanilino)-2-oxoethyl]-[(2-fluorophenyl)methyl]-methylazanium.
| Compound Name | [2-(2-ethoxycarbonylanilino)-2-oxoethyl]-[(2-fluorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9035217 |
| Molecular Formula | C19H22FN2O3+ |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [2-(2-ethoxycarbonylanilino)-2-oxoethyl]-[(2-fluorophenyl)methyl]-methylazanium |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C[NH+](C)Cc1ccccc1F |
| InChI | InChI=1S/C19H21FN2O3/c1-3-25-19(24)15-9-5-7-11-17(15)21-18(23)13-22(2)12-14-8-4-6-10-16(14)20/h4-11H,3,12-13H2,1-2H3,(H,21,23)/p+1 |
| InChIKey | PARRBDLIQMYSFT-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |