C19H23N2O2+ — CID 9465682
[2-(2-acetylanilino)-2-oxoethyl]-methyl-[(2-methylphenyl)methyl]azanium (PubChem CID 9465682) has the molecular formula C19H23N2O2+ and a molecular weight of 311.41 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl]-methyl-[(2-methylphenyl)methyl]azanium.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl]-methyl-[(2-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9465682 |
| Molecular Formula | C19H23N2O2+ |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl]-methyl-[(2-methylphenyl)methyl]azanium |
| SMILES | CC(=O)c1ccccc1NC(=O)C[NH+](C)Cc1ccccc1C |
| InChI | InChI=1S/C19H22N2O2/c1-14-8-4-5-9-16(14)12-21(3)13-19(23)20-18-11-7-6-10-17(18)15(2)22/h4-11H,12-13H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | AENMOIJHISTXSA-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |