C18H22N3O3+ — CID 8964419
methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]-[(2-methylphenyl)methyl]azanium (PubChem CID 8964419) has the molecular formula C18H22N3O3+ and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]-[(2-methylphenyl)methyl]azanium.
| Compound Name | methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]-[(2-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8964419 |
| Molecular Formula | C18H22N3O3+ |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]-[(2-methylphenyl)methyl]azanium |
| SMILES | Cc1ccccc1C[NH+](C)CC(=O)Nc1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C18H21N3O3/c1-13-6-4-5-7-15(13)11-20(3)12-18(22)19-17-9-8-16(21(23)24)10-14(17)2/h4-10H,11-12H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | VZLKQOOXYSDIKE-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|