C16H23N4O5+ — CID 8711560
methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]-(2-morpholin-4-yl-2-oxoethyl)azanium (PubChem CID 8711560) has the molecular formula C16H23N4O5+ and a molecular weight of 351.38 g/mol. Its IUPAC name is methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]-(2-morpholin-4-yl-2-oxoethyl)azanium.
| Compound Name | methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]-(2-morpholin-4-yl-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 8711560 |
| Molecular Formula | C16H23N4O5+ |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | methyl-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]-(2-morpholin-4-yl-2-oxoethyl)azanium |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C[NH+](C)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H22N4O5/c1-12-9-13(20(23)24)3-4-14(12)17-15(21)10-18(2)11-16(22)19-5-7-25-8-6-19/h3-4,9H,5-8,10-11H2,1-2H3,(H,17,21)/p+1 |
| InChIKey | YXFDCHRJWBWTOJ-UHFFFAOYSA-O |
| XLogP | -0.78 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|