C16H23FN3O3+ — CID 8711576
[2-(3-fluoro-4-methylanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium (PubChem CID 8711576) has the molecular formula C16H23FN3O3+ and a molecular weight of 324.38 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 8711576 |
| Molecular Formula | C16H23FN3O3+ |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
| SMILES | Cc1ccc(NC(=O)C[NH+](C)CC(=O)N2CCOCC2)cc1F |
| InChI | InChI=1S/C16H22FN3O3/c1-12-3-4-13(9-14(12)17)18-15(21)10-19(2)11-16(22)20-5-7-23-8-6-20/h3-4,9H,5-8,10-11H2,1-2H3,(H,18,21)/p+1 |
| InChIKey | DRNKNWSFIVRLDG-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |