C17H25ClN3O4+ — CID 8693249
[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium (PubChem CID 8693249) has the molecular formula C17H25ClN3O4+ and a molecular weight of 370.86 g/mol. Its IUPAC name is [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium.
| Compound Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 8693249 |
| Molecular Formula | C17H25ClN3O4+ |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
| SMILES | C[NH+](CC(=O)NCCOc1ccc(Cl)cc1)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H24ClN3O4/c1-20(13-17(23)21-7-10-24-11-8-21)12-16(22)19-6-9-25-15-4-2-14(18)3-5-15/h2-5H,6-13H2,1H3,(H,19,22)/p+1 |
| InChIKey | FHLSCAYAYOCPKP-UHFFFAOYSA-O |
| XLogP | -0.79 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|