C16H20ClN2O2S+ — CID 8925889
[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium (PubChem CID 8925889) has the molecular formula C16H20ClN2O2S+ and a molecular weight of 339.87 g/mol. Its IUPAC name is [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium.
| Compound Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 8925889 |
| Molecular Formula | C16H20ClN2O2S+ |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
| SMILES | C[NH+](CC(=O)NCCOc1ccc(Cl)cc1)Cc1ccsc1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-19(10-13-6-9-22-12-13)11-16(20)18-7-8-21-15-4-2-14(17)3-5-15/h2-6,9,12H,7-8,10-11H2,1H3,(H,18,20)/p+1 |
| InChIKey | AXZIRTFBQNZAMJ-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|