C14H16FN2OS+ — CID 9054520
[2-(2-fluoroanilino)-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium (PubChem CID 9054520) has the molecular formula C14H16FN2OS+ and a molecular weight of 279.36 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 9054520 |
| Molecular Formula | C14H16FN2OS+ |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1F)Cc1ccsc1 |
| InChI | InChI=1S/C14H15FN2OS/c1-17(8-11-6-7-19-10-11)9-14(18)16-13-5-3-2-4-12(13)15/h2-7,10H,8-9H2,1H3,(H,16,18)/p+1 |
| InChIKey | HNZYTMYXGBLHCE-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |