C17H20FN2O+ — CID 8541486
benzyl-ethyl-[2-(2-fluoroanilino)-2-oxoethyl]azanium (PubChem CID 8541486) has the molecular formula C17H20FN2O+ and a molecular weight of 287.36 g/mol. Its IUPAC name is benzyl-ethyl-[2-(2-fluoroanilino)-2-oxoethyl]azanium.
| Compound Name | benzyl-ethyl-[2-(2-fluoroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8541486 |
| Molecular Formula | C17H20FN2O+ |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | benzyl-ethyl-[2-(2-fluoroanilino)-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccccc1F)Cc1ccccc1 |
| InChI | InChI=1S/C17H19FN2O/c1-2-20(12-14-8-4-3-5-9-14)13-17(21)19-16-11-7-6-10-15(16)18/h3-11H,2,12-13H2,1H3,(H,19,21)/p+1 |
| InChIKey | BORJUBFDODKVJE-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |