C20H24FN2O4+ — CID 9349183
ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-(2-methoxycarbonylanilino)-2-oxoethyl]azanium (PubChem CID 9349183) has the molecular formula C20H24FN2O4+ and a molecular weight of 375.42 g/mol. Its IUPAC name is ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-(2-methoxycarbonylanilino)-2-oxoethyl]azanium.
| Compound Name | ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-(2-methoxycarbonylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9349183 |
| Molecular Formula | C20H24FN2O4+ |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-(2-methoxycarbonylanilino)-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccccc1C(=O)OC)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C20H23FN2O4/c1-4-23(12-14-9-10-18(26-2)16(21)11-14)13-19(24)22-17-8-6-5-7-15(17)20(25)27-3/h5-11H,4,12-13H2,1-3H3,(H,22,24)/p+1 |
| InChIKey | HKYQJMHOGPOTDI-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |