C19H22FN2O4+ — CID 9431684
(3-fluoro-4-methoxyphenyl)methyl-[2-(2-methoxycarbonylanilino)-2-oxoethyl]-methylazanium (PubChem CID 9431684) has the molecular formula C19H22FN2O4+ and a molecular weight of 361.39 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl-[2-(2-methoxycarbonylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl-[2-(2-methoxycarbonylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9431684 |
| Molecular Formula | C19H22FN2O4+ |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl-[2-(2-methoxycarbonylanilino)-2-oxoethyl]-methylazanium |
| SMILES | COC(=O)c1ccccc1NC(=O)C[NH+](C)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C19H21FN2O4/c1-22(11-13-8-9-17(25-2)15(20)10-13)12-18(23)21-16-7-5-4-6-14(16)19(24)26-3/h4-10H,11-12H2,1-3H3,(H,21,23)/p+1 |
| InChIKey | FGEQIOBQXCOWBT-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |