C18H19FN3O2+ — CID 9431380
[2-(2-cyanoanilino)-2-oxoethyl]-[(3-fluoro-4-methoxyphenyl)methyl]-methylazanium (PubChem CID 9431380) has the molecular formula C18H19FN3O2+ and a molecular weight of 328.37 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl]-[(3-fluoro-4-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl]-[(3-fluoro-4-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9431380 |
| Molecular Formula | C18H19FN3O2+ |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl]-[(3-fluoro-4-methoxyphenyl)methyl]-methylazanium |
| SMILES | COc1ccc(C[NH+](C)CC(=O)Nc2ccccc2C#N)cc1F |
| InChI | InChI=1S/C18H18FN3O2/c1-22(11-13-7-8-17(24-2)15(19)9-13)12-18(23)21-16-6-4-3-5-14(16)10-20/h3-9H,11-12H2,1-2H3,(H,21,23)/p+1 |
| InChIKey | KFUWHIHQTLSYNF-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |