C18H19ClN3O2+ — CID 9222357
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(4-cyanophenyl)methyl]-methylazanium (PubChem CID 9222357) has the molecular formula C18H19ClN3O2+ and a molecular weight of 344.82 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(4-cyanophenyl)methyl]-methylazanium.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(4-cyanophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9222357 |
| Molecular Formula | C18H19ClN3O2+ |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(4-cyanophenyl)methyl]-methylazanium |
| SMILES | COc1ccc(Cl)cc1NC(=O)C[NH+](C)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H18ClN3O2/c1-22(11-14-5-3-13(10-20)4-6-14)12-18(23)21-16-9-15(19)7-8-17(16)24-2/h3-9H,11-12H2,1-2H3,(H,21,23)/p+1 |
| InChIKey | JCNPNECOMDWSDW-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |