C18H22ClN2O3+ — CID 2698245
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium (PubChem CID 2698245) has the molecular formula C18H22ClN2O3+ and a molecular weight of 349.84 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 2698245 |
| Molecular Formula | C18H22ClN2O3+ |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium |
| SMILES | COc1cccc(C[NH+](C)CC(=O)Nc2cc(Cl)ccc2OC)c1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-21(11-13-5-4-6-15(9-13)23-2)12-18(22)20-16-10-14(19)7-8-17(16)24-3/h4-10H,11-12H2,1-3H3,(H,20,22)/p+1 |
| InChIKey | SRUFFVALVXUONI-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |