C17H19BrFN2O2+ — CID 8794639
[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium (PubChem CID 8794639) has the molecular formula C17H19BrFN2O2+ and a molecular weight of 382.25 g/mol. Its IUPAC name is [2-(4-bromo-2-fluoroanilino)-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8794639 |
| Molecular Formula | C17H19BrFN2O2+ |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl]-[(3-methoxyphenyl)methyl]-methylazanium |
| SMILES | COc1cccc(C[NH+](C)CC(=O)Nc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C17H18BrFN2O2/c1-21(10-12-4-3-5-14(8-12)23-2)11-17(22)20-16-7-6-13(18)9-15(16)19/h3-9H,10-11H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | PXWRWRDMJKRBNE-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |