C18H19ClN3OS+ — CID 2699474
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium (PubChem CID 2699474) has the molecular formula C18H19ClN3OS+ and a molecular weight of 360.89 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 2699474 |
| Molecular Formula | C18H19ClN3OS+ |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-methyl-[(4-methylsulfanylphenyl)methyl]azanium |
| SMILES | CSc1ccc(C[NH+](C)CC(=O)Nc2cc(Cl)ccc2C#N)cc1 |
| InChI | InChI=1S/C18H18ClN3OS/c1-22(11-13-3-7-16(24-2)8-4-13)12-18(23)21-17-9-15(19)6-5-14(17)10-20/h3-9H,11-12H2,1-2H3,(H,21,23)/p+1 |
| InChIKey | LBVBRNYCWAMEBQ-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |