C20H17ClN2O4S — CID 7829250
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-(4-methylsulfanylphenyl)-4-oxobutanoate (PubChem CID 7829250) has the molecular formula C20H17ClN2O4S and a molecular weight of 416.89 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-(4-methylsulfanylphenyl)-4-oxobutanoate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-(4-methylsulfanylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7829250 |
| Molecular Formula | C20H17ClN2O4S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-(4-methylsulfanylphenyl)-4-oxobutanoate |
| SMILES | CSc1ccc(C(=O)CCC(=O)OCC(=O)Nc2cc(Cl)ccc2C#N)cc1 |
| InChI | InChI=1S/C20H17ClN2O4S/c1-28-16-6-3-13(4-7-16)18(24)8-9-20(26)27-12-19(25)23-17-10-15(21)5-2-14(17)11-22/h2-7,10H,8-9,12H2,1H3,(H,23,25) |
| InChIKey | NDPJGZUAEGSZLK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |