C18H14Cl2N2O3S — CID 7821141
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 7821141) has the molecular formula C18H14Cl2N2O3S and a molecular weight of 409.29 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7821141 |
| Molecular Formula | C18H14Cl2N2O3S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | C[C@@H](Sc1ccc(Cl)cc1)C(=O)OCC(=O)Nc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C18H14Cl2N2O3S/c1-11(26-15-6-4-13(19)5-7-15)18(24)25-10-17(23)22-16-8-14(20)3-2-12(16)9-21/h2-8,11H,10H2,1H3,(H,22,23)/t11-/m1/s1 |
| InChIKey | OXXYQTWBSAELRZ-LLVKDONJSA-N |
| XLogP | 4.53 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |