C19H21ClN2O3S — CID 7821142
[2-[4-(dimethylamino)anilino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 7821142) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7821142 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | C[C@H](Sc1ccc(Cl)cc1)C(=O)OCC(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H21ClN2O3S/c1-13(26-17-10-4-14(20)5-11-17)19(24)25-12-18(23)21-15-6-8-16(9-7-15)22(2)3/h4-11,13H,12H2,1-3H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | HNWFHEYVRQGPKX-ZDUSSCGKSA-N |
| XLogP | 4.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|