C18H16ClF2NO4S — CID 8867019
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (2S)-2-(4-chlorophenoxy)propanoate (PubChem CID 8867019) has the molecular formula C18H16ClF2NO4S and a molecular weight of 415.85 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (2S)-2-(4-chlorophenoxy)propanoate.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (2S)-2-(4-chlorophenoxy)propanoate |
|---|---|
| PubChem CID | 8867019 |
| Molecular Formula | C18H16ClF2NO4S |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (2S)-2-(4-chlorophenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(Cl)cc1)C(=O)OCC(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C18H16ClF2NO4S/c1-11(26-14-6-2-12(19)3-7-14)17(24)25-10-16(23)22-13-4-8-15(9-5-13)27-18(20)21/h2-9,11,18H,10H2,1H3,(H,22,23)/t11-/m0/s1 |
| InChIKey | CESGMDGREMRTCV-NSHDSACASA-N |
| XLogP | 4.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |