C19H18ClNO4S — CID 7821261
[2-(4-acetylanilino)-2-oxoethyl] (2S)-2-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 7821261) has the molecular formula C19H18ClNO4S and a molecular weight of 391.88 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] (2S)-2-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] (2S)-2-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7821261 |
| Molecular Formula | C19H18ClNO4S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] (2S)-2-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)[C@H](C)Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18ClNO4S/c1-12(22)14-3-7-16(8-4-14)21-18(23)11-25-19(24)13(2)26-17-9-5-15(20)6-10-17/h3-10,13H,11H2,1-2H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | LVEHVIKOGTUFSS-ZDUSSCGKSA-N |
| XLogP | 4.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |