C21H23ClN2O4 — CID 7133431
[2-(4-acetamidoanilino)-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7133431) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7133431 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)[C@H](c2ccc(Cl)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-13(2)20(15-4-6-16(22)7-5-15)21(27)28-12-19(26)24-18-10-8-17(9-11-18)23-14(3)25/h4-11,13,20H,12H2,1-3H3,(H,23,25)(H,24,26)/t20-/m0/s1 |
| InChIKey | YGNNRQJJLVGTGY-FQEVSTJZSA-N |
| XLogP | 4.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |