C23H22ClNO3 — CID 7209317
[2-(naphthalen-1-ylamino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7209317) has the molecular formula C23H22ClNO3 and a molecular weight of 395.89 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7209317 |
| Molecular Formula | C23H22ClNO3 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OCC(=O)Nc1cccc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClNO3/c1-15(2)22(17-10-12-18(24)13-11-17)23(27)28-14-21(26)25-20-9-5-7-16-6-3-4-8-19(16)20/h3-13,15,22H,14H2,1-2H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | OZEZTXRWMMBBSZ-JOCHJYFZSA-N |
| XLogP | 5.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |