C19H14ClNO3 — CID 2629383
[2-(naphthalen-1-ylamino)-2-oxoethyl] 4-chlorobenzoate (PubChem CID 2629383) has the molecular formula C19H14ClNO3 and a molecular weight of 339.78 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-chlorobenzoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 2629383 |
| Molecular Formula | C19H14ClNO3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)cc1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H14ClNO3/c20-15-10-8-14(9-11-15)19(23)24-12-18(22)21-17-7-3-5-13-4-1-2-6-16(13)17/h1-11H,12H2,(H,21,22) |
| InChIKey | VLTUPDXUTQURQQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |