C28H23ClN2O5 — CID 17257741
[2-(naphthalen-1-ylamino)-2-oxoethyl] 4-[4-(4-chlorophenoxy)anilino]-4-oxobutanoate (PubChem CID 17257741) has the molecular formula C28H23ClN2O5 and a molecular weight of 502.95 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-[4-(4-chlorophenoxy)anilino]-4-oxobutanoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-[4-(4-chlorophenoxy)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17257741 |
| Molecular Formula | C28H23ClN2O5 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-[4-(4-chlorophenoxy)anilino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCC(=O)Nc1cccc2ccccc12)Nc1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H23ClN2O5/c29-20-8-12-22(13-9-20)36-23-14-10-21(11-15-23)30-26(32)16-17-28(34)35-18-27(33)31-25-7-3-5-19-4-1-2-6-24(19)25/h1-15H,16-18H2,(H,30,32)(H,31,33) |
| InChIKey | ZRPKKOFUBXCXDU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |