C19H19ClN2O5 — CID 17257762
[2-(3-methoxyanilino)-2-oxoethyl] 4-(4-chloroanilino)-4-oxobutanoate (PubChem CID 17257762) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] 4-(4-chloroanilino)-4-oxobutanoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] 4-(4-chloroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 17257762 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] 4-(4-chloroanilino)-4-oxobutanoate |
| SMILES | COc1cccc(NC(=O)COC(=O)CCC(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H19ClN2O5/c1-26-16-4-2-3-15(11-16)22-18(24)12-27-19(25)10-9-17(23)21-14-7-5-13(20)6-8-14/h2-8,11H,9-10,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | CROKRTPYFTWIFS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |