C20H20Cl2N2O6 — CID 17259504
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-(3,4-dichloroanilino)-4-oxobutanoate (PubChem CID 17259504) has the molecular formula C20H20Cl2N2O6 and a molecular weight of 455.29 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-(3,4-dichloroanilino)-4-oxobutanoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-(3,4-dichloroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 17259504 |
| Molecular Formula | C20H20Cl2N2O6 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-(3,4-dichloroanilino)-4-oxobutanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)CCC(=O)Nc2ccc(Cl)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C20H20Cl2N2O6/c1-28-13-4-6-16(17(10-13)29-2)24-19(26)11-30-20(27)8-7-18(25)23-12-3-5-14(21)15(22)9-12/h3-6,9-10H,7-8,11H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | JVDFWIJAZAIDHB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |