C21H22ClN3O7 — CID 17260595
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutanoate (PubChem CID 17260595) has the molecular formula C21H22ClN3O7 and a molecular weight of 463.87 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutanoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 17260595 |
| Molecular Formula | C21H22ClN3O7 |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)CCC(=O)NNC(=O)c2ccccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C21H22ClN3O7/c1-30-13-7-8-16(17(11-13)31-2)23-19(27)12-32-20(28)10-9-18(26)24-25-21(29)14-5-3-4-6-15(14)22/h3-8,11H,9-10,12H2,1-2H3,(H,23,27)(H,24,26)(H,25,29) |
| InChIKey | GMXZISSOIDHMKF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|