C18H18Cl2N2O5 — CID 3910876
N-(2,3-dichlorophenyl)-2-[2-(2,4-dimethoxyanilino)-2-oxoethoxy]acetamide (PubChem CID 3910876) has the molecular formula C18H18Cl2N2O5 and a molecular weight of 413.26 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[2-(2,4-dimethoxyanilino)-2-oxoethoxy]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[2-(2,4-dimethoxyanilino)-2-oxoethoxy]acetamide |
|---|---|
| PubChem CID | 3910876 |
| Molecular Formula | C18H18Cl2N2O5 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[2-(2,4-dimethoxyanilino)-2-oxoethoxy]acetamide |
| SMILES | COc1ccc(NC(=O)COCC(=O)Nc2cccc(Cl)c2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H18Cl2N2O5/c1-25-11-6-7-13(15(8-11)26-2)21-16(23)9-27-10-17(24)22-14-5-3-4-12(19)18(14)20/h3-8H,9-10H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | XRKXXKQXGGQAIQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |