C17H19NO5 — CID 868059
N-(2,4-dimethoxyphenyl)-2-(4-methoxyphenoxy)acetamide (PubChem CID 868059) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 868059 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)Nc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C17H19NO5/c1-20-12-4-6-13(7-5-12)23-11-17(19)18-15-9-8-14(21-2)10-16(15)22-3/h4-10H,11H2,1-3H3,(H,18,19) |
| InChIKey | KQKMGNASWUYMKD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |