C18H19NO7 — CID 45397323
4-[2-(2,4-dimethoxyanilino)-2-oxoethoxy]-3-methoxybenzoic acid (PubChem CID 45397323) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is 4-[2-(2,4-dimethoxyanilino)-2-oxoethoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[2-(2,4-dimethoxyanilino)-2-oxoethoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 45397323 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-[2-(2,4-dimethoxyanilino)-2-oxoethoxy]-3-methoxybenzoic acid |
| SMILES | COc1ccc(NC(=O)COc2ccc(C(=O)O)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C18H19NO7/c1-23-12-5-6-13(15(9-12)24-2)19-17(20)10-26-14-7-4-11(18(21)22)8-16(14)25-3/h4-9H,10H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | PEGPWTBIGVBMSI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |