C20H22N2O6 — CID 24534009
2-(2-acetamido-5-acetylphenoxy)-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 24534009) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-(2-acetamido-5-acetylphenoxy)-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(2-acetamido-5-acetylphenoxy)-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24534009 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-(2-acetamido-5-acetylphenoxy)-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2cc(C(C)=O)ccc2NC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C20H22N2O6/c1-12(23)14-5-7-17(21-13(2)24)19(9-14)28-11-20(25)22-16-8-6-15(26-3)10-18(16)27-4/h5-10H,11H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | NQOFACVBXAJXIG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |