C24H23NO6 — CID 2605697
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-phenylmethoxybenzoate (PubChem CID 2605697) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-phenylmethoxybenzoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 2605697 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-phenylmethoxybenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccccc2OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C24H23NO6/c1-28-18-12-13-20(22(14-18)29-2)25-23(26)16-31-24(27)19-10-6-7-11-21(19)30-15-17-8-4-3-5-9-17/h3-14H,15-16H2,1-2H3,(H,25,26) |
| InChIKey | VPQKPYOYTXSFGZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |