About [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate
[2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate (PubChem CID 2358793) has the molecular formula C23H20O5
and a molecular weight of 376.41 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate |
| PubChem CID | 2358793 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H20O5/c1-26-19-13-11-18(12-14-19)21(24)16-28-23(25)20-9-5-6-10-22(20)27-15-17-7-3-2-4-8-17/h2-14H,15-16H2,1H3 |
| InChIKey | FJVOLGRCWSSTMK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate?
The IUPAC name of [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate (CID 2358793) is [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate.
What is the SMILES notation for [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate?
The canonical SMILES for [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate is COc1ccc(C(=O)COC(=O)c2ccccc2OCc2ccccc2)cc1.
What is the InChIKey of [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate?
The InChIKey is FJVOLGRCWSSTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20O5/c1-26-19-13-11-18(12-14-19)21(24)16-28-23(25)20-9-5-6-10-22(20)27-15-17-7-3-2-4-8-17/h2-14H,15-16H2,1H3.
What are the key properties of [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate?
[2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate has a molecular weight of 376.41 g/mol, XLogP of 4.31, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methoxyphenyl)-2-oxoethyl] 2-phenylmethoxybenzoate is sourced from PubChem (CID 2358793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).