About [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate
[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate (PubChem CID 23988356) has the molecular formula C27H22O4
and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate.
Molecular Properties
| Compound Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate |
| PubChem CID | 23988356 |
| Molecular Formula | C27H22O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate |
| SMILES | COc1ccc2cc(C(=O)COC(=O)c3ccccc3Cc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C27H22O4/c1-30-24-14-13-20-16-23(12-11-21(20)17-24)26(28)18-31-27(29)25-10-6-5-9-22(25)15-19-7-3-2-4-8-19/h2-14,16-17H,15,18H2,1H3 |
| InChIKey | RSSUCUPTLZGSLN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate?
The IUPAC name of [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate (CID 23988356) is [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate.
What is the SMILES notation for [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate?
The canonical SMILES for [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate is COc1ccc2cc(C(=O)COC(=O)c3ccccc3Cc3ccccc3)ccc2c1.
What is the InChIKey of [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate?
The InChIKey is RSSUCUPTLZGSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22O4/c1-30-24-14-13-20-16-23(12-11-21(20)17-24)26(28)18-31-27(29)25-10-6-5-9-22(25)15-19-7-3-2-4-8-19/h2-14,16-17H,15,18H2,1H3.
What are the key properties of [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate?
[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate has a molecular weight of 410.47 g/mol, XLogP of 5.48, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-benzylbenzoate is sourced from PubChem (CID 23988356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).