C22H16F2O3 — CID 7809464
[2-(3,4-difluorophenyl)-2-oxoethyl] 2-benzylbenzoate (PubChem CID 7809464) has the molecular formula C22H16F2O3 and a molecular weight of 366.36 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 2-benzylbenzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 7809464 |
| Molecular Formula | C22H16F2O3 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-benzylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H16F2O3/c23-19-11-10-17(13-20(19)24)21(25)14-27-22(26)18-9-5-4-8-16(18)12-15-6-2-1-3-7-15/h1-11,13H,12,14H2 |
| InChIKey | BGGMXNYLBWPMLP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |