C22H17Cl2NO3 — CID 2334993
[2-(3,5-dichloroanilino)-2-oxoethyl] 2-benzylbenzoate (PubChem CID 2334993) has the molecular formula C22H17Cl2NO3 and a molecular weight of 414.29 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] 2-benzylbenzoate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 2334993 |
| Molecular Formula | C22H17Cl2NO3 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-benzylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cc1ccccc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2NO3/c23-17-11-18(24)13-19(12-17)25-21(26)14-28-22(27)20-9-5-4-8-16(20)10-15-6-2-1-3-7-15/h1-9,11-13H,10,14H2,(H,25,26) |
| InChIKey | UHPFXOYIKJJZCL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |