C24H22ClNO3 — CID 7809595
[2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-benzylbenzoate (PubChem CID 7809595) has the molecular formula C24H22ClNO3 and a molecular weight of 407.90 g/mol. Its IUPAC name is [2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-benzylbenzoate.
| Compound Name | [2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 7809595 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-benzylbenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccccc1Cc1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C24H22ClNO3/c1-17(20-12-7-8-14-22(20)25)26-23(27)16-29-24(28)21-13-6-5-11-19(21)15-18-9-3-2-4-10-18/h2-14,17H,15-16H2,1H3,(H,26,27)/t17-/m1/s1 |
| InChIKey | ROSBYDURXNOMNY-QGZVFWFLSA-N |
| XLogP | 4.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |