C24H19ClN2O3 — CID 7522833
[2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate (PubChem CID 7522833) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate.
| Compound Name | [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 7522833 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccccc1-c1ccccc1C#N)c1ccccc1Cl |
| InChI | InChI=1S/C24H19ClN2O3/c1-16(18-9-6-7-13-22(18)25)27-23(28)15-30-24(29)21-12-5-4-11-20(21)19-10-3-2-8-17(19)14-26/h2-13,16H,15H2,1H3,(H,27,28)/t16-/m0/s1 |
| InChIKey | XYXRWSIZWIJFSD-INIZCTEOSA-N |
| XLogP | 4.91 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |